For research use only. Not for therapeutic Use.
4-Amino-3-tert-butylbenzoic acid(Cat No.:L010558)is an important compound in organic synthesis and pharmaceutical research. Its structure, featuring an amino group and a tert-butyl substitution on a benzoic acid core, provides versatility for chemical modifications. This compound is used as an intermediate in the synthesis of various bioactive molecules, including potential drug candidates. Its reactivity allows for the creation of novel compounds in medicinal chemistry, making it valuable for drug discovery. Additionally, it serves as a building block in the development of agrochemicals and fine chemicals.
CAS Number | 51990-94-4 |
Molecular Formula | C11H15NO2 |
Purity | ≥95% |
IUPAC Name | 4-amino-3-tert-butylbenzoic acid |
InChI | InChI=1S/C11H15NO2/c1-11(2,3)8-6-7(10(13)14)4-5-9(8)12/h4-6H,12H2,1-3H3,(H,13,14) |
InChIKey | KHLPOCRRHPIABB-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=C(C=CC(=C1)C(=O)O)N |