For research use only. Not for therapeutic Use.
4-Amino-3,2’-dimethylbiphenyl Hydrochloride is a high-purity compound essential for advanced pharmaceutical and chemical research. This biphenyl derivative is crucial for studies involving organic synthesis, medicinal chemistry, and material science. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 58109-32-3 |
Synonyms | 2’,3-Dimethyl-[1,1’-biphenyl]-4-amine Hydrochloride |
Molecular Formula | C14H16ClN |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-methyl-4-(2-methylphenyl)aniline;hydrochloride |
InChI | InChI=1S/C14H15N.ClH/c1-10-5-3-4-6-13(10)12-7-8-14(15)11(2)9-12;/h3-9H,15H2,1-2H3;1H |
InChIKey | LKINQJGXXOXEFC-UHFFFAOYSA-N |
SMILES | CC1=CC=CC=C1C2=CC(=C(C=C2)N)C.Cl |