For research use only. Not for therapeutic Use.
4-Amino-4′-iodobiphenyl is an organic compound with the formula C12H9IN. It consists of a biphenyl structure, where two benzene rings are connected by a single bond. The molecule is substituted with an amino group (-NH2) at the 4-position of one ring and an iodine atom (I) at the 4′-position of the other ring. This compound is of interest in organic synthesis, particularly for its reactivity in coupling reactions or as a precursor for the synthesis of more complex molecules in materials science or medicinal chemistry.
| Catalog Number | L019347 |
| CAS Number | 7285-77-0 |
| Molecular Formula | C12H10IN |
| Purity | ≥95% |
| IUPAC Name | 4-(4-iodophenyl)aniline |
| InChI | InChI=1S/C12H10IN/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,14H2 |
| InChIKey | MSHUACKEOWOIGP-UHFFFAOYSA-N |
