For research use only. Not for therapeutic Use.
4-Amino-5-chloronicotinonitrile(Cat No.:L031925)is a chlorinated pyridine derivative with an amino group at the 4-position and a nitrile group at the 5-position. This compound is widely used in pharmaceutical and chemical research as a key intermediate in synthesizing bioactive molecules, including potential therapeutic agents. Its unique structure allows for various chemical modifications, making it valuable in developing complex organic compounds. 4-Amino-5-chloronicotinonitrile is essential for researchers focused on drug discovery, agrochemicals, and the advancement of novel synthetic pathways in medicinal chemistry.
CAS Number | 1706454-74-1 |
Molecular Formula | C6H4ClN3 |
Purity | ≥95% |
IUPAC Name | 4-amino-5-chloropyridine-3-carbonitrile |
InChI | InChI=1S/C6H4ClN3/c7-5-3-10-2-4(1-8)6(5)9/h2-3H,(H2,9,10) |
InChIKey | IETAIDPTMBIJIK-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C=N1)Cl)N)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |