Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Amino-5-(diethylamino)-2-phenylpyridazin-3-one
For research use only. Not for therapeutic Use.
4-Amino-5-(diethylamino)-2-phenylpyridazin-3-one(CAT: L000390) is a compound with potential applications in pharmaceutical and organic chemistry. Its unique structure containing both an amino group and a diethylamino group makes it a valuable intermediate in organic synthesis. In pharmaceutical chemistry, it can serve as a key building block for creating molecules with potential applications in drug development.
CAS Number | 194016-09-6 |
Molecular Formula | C14H18N4O |
Purity | ≥95% |
IUPAC Name | 4-amino-5-(diethylamino)-2-phenylpyridazin-3-one |
InChI | InChI=1S/C14H18N4O/c1-3-17(4-2)12-10-16-18(14(19)13(12)15)11-8-6-5-7-9-11/h5-10H,3-4,15H2,1-2H3 |
InChIKey | FDAIPXMRBFMXKP-UHFFFAOYSA-N |