For research use only. Not for therapeutic Use.
4-Amino-5-(formamidomethyl)-2-methylpyrimidine is a pyrimidine derivative used in pharmaceutical and biochemical research. It serves as a key intermediate in the synthesis of various biologically active compounds. This compound is essential for studying nucleic acid analogs and developing new therapeutic agents, ensuring precise and reliable results in advanced drug development and chemical synthesis.
Catalog Number | R016350 |
CAS Number | 1886-34-6 |
Synonyms | 2-Methyl-4-amino-5-(formylaminomethyl)pyrimidine; 4-Amino-5-((formylamino)methyl)-2-methylpyrimidine; N-[(4-Amino-2-methyl-5-pyrimidinyl)methyl]formamide; |
Molecular Formula | C7H10N4O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide |
InChI | InChI=1S/C7H10N4O/c1-5-10-3-6(2-9-4-12)7(8)11-5/h3-4H,2H2,1H3,(H,9,12)(H2,8,10,11) |
InChIKey | PVWNFAGYFUUDRC-UHFFFAOYSA-N |
SMILES | CC1=NC=C(C(=N1)N)CNC=O |