For research use only. Not for therapeutic Use.
4-Amino-5-nitropyridazin-3-ol is a nitro-substituted pyridazinol derivative with an amino group at the 4-position and a nitro group at the 5-position on the pyridazine ring. This compound is used in pharmaceutical research and organic synthesis due to its reactivity and versatility, allowing for various chemical modifications. Its structure is ideal for creating bioactive compounds, making it valuable in the development of new therapeutic agents. With stability and unique functional groups, it supports efficient synthesis in medicinal chemistry applications.
Catalog Number | L039625 |
CAS Number | 6381-47-1 |
Molecular Formula | C4H4N4O3 |
Purity | ≥95% |
IUPAC Name | 5-amino-4-nitro-1H-pyridazin-6-one |
InChI | InChI=1S/C4H4N4O3/c5-3-2(8(10)11)1-6-7-4(3)9/h1H,(H2,5,6)(H,7,9) |
InChIKey | ZLLZXWINJFUJIP-UHFFFAOYSA-N |
SMILES | C1=NNC(=O)C(=C1[N+](=O)[O-])N |