For research use only. Not for therapeutic Use.
4-Amino-6-chloro-N3-methyl-1,3-benzenedisulfonamide is a sulfonamide derivative crucial in pharmaceutical research. It is commonly used for studying antimicrobial properties and developing therapeutic agents. This compound plays a significant role in understanding sulfonamide mechanisms, offering reliable and precise results in drug development and biochemical investigations.
| Catalog Number | R017282 |
| CAS Number | 13659-98-8 |
| Synonyms | 5-Chloro-2-(N-methylsulfamoyl)-4-sulfamoylaniline; 4-Amino-6-chloro-N3-methyl-m-benzenedisulfonamide; USP Methyclothiazide Related Compound A |
| Molecular Formula | C7H10ClN3O4S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide |
| InChI | InChI=1S/C7H10ClN3O4S2/c1-11-17(14,15)7-3-6(16(10,12)13)4(8)2-5(7)9/h2-3,11H,9H2,1H3,(H2,10,12,13) |
| InChIKey | HZLMCYKKQJTLER-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1N)Cl)S(=O)(=O)N |
