For research use only. Not for therapeutic Use.
4-Amino-6-fluoro-3H-isobenzofuran-1-one(Cat No.:M125830)is a chemically intricate compound featuring an isobenzofuranone backbone, an amino group, and a fluorine atom. This structure imparts unique electronic and chemical properties, making it valuable in pharmaceutical synthesis, particularly for creating molecules with potential antidepressant or anticonvulsant activities. The fluorine atom enhances metabolic stability and binding affinity to target proteins, while the amino group allows for further chemical modifications. 4-Amino-6-fluoro-3H-isobenzofuran-1-one serves as a versatile intermediate in medicinal chemistry, facilitating the development of novel therapeutic agents with improved pharmacokinetic properties.
CAS Number | 1207453-91-5 |
Molecular Formula | C8H6FNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-amino-6-fluoro-3H-2-benzofuran-1-one |
InChI | InChI=1S/C8H6FNO2/c9-4-1-5-6(7(10)2-4)3-12-8(5)11/h1-2H,3,10H2 |
InChIKey | DSZCXDVJAIFZLL-UHFFFAOYSA-N |
SMILES | C1C2=C(C=C(C=C2N)F)C(=O)O1 |