For research use only. Not for therapeutic Use.
4-Amino-N-(cyclopropylmethyl)benzenesulfonamide(Cat No.:L007681), is a chemical compound featuring an amino group attached to a sulfonamide group, with a cyclopropylmethyl substituent on the benzene ring. This specific molecular structure is significant in medicinal chemistry. Researchers utilize it as a valuable building block in the development of specialized organic molecules, particularly in the field of pharmaceuticals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery.
Catalog Number | L007681 |
CAS Number | 477723-17-4 |
Molecular Formula | C10H14N2O2S |
Purity | ≥95% |
IUPAC Name | 4-amino-N-(cyclopropylmethyl)benzenesulfonamide |
InChI | InChI=1S/C10H14N2O2S/c11-9-3-5-10(6-4-9)15(13,14)12-7-8-1-2-8/h3-6,8,12H,1-2,7,11H2 |
InChIKey | XBXNGYRXFLXLHD-UHFFFAOYSA-N |
SMILES | C1CC1CNS(=O)(=O)C2=CC=C(C=C2)N |