For research use only. Not for therapeutic Use.
4-amino Nicotinic acid is a synthetic intermediate that has been used in various syntheses.
| Catalog Number | R066836 |
| CAS Number | 7418-65-7 |
| Synonyms | 4-Aminopyridine-3-Carboxylic Acid;NSC 266130 |
| Molecular Formula | C6H6N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-aminopyridine-3-carboxylic acid |
| InChI | InChI=1S/C6H6N2O2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | IASBMUIXBJNMDW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1N)C(=O)O |
| Reference | 1.Heber, D.,Ravens, U. and Schulze, T. Synthesis and positive inotropic activity of several 5-aminopyrido[2,3-d]pyrimidines. Part 5: Compounds with positive inotropic activity. Die. Pharmazie. 48(7), 509-513 (1993). |
