For research use only. Not for therapeutic Use.
4-Aminoacetophenone (Cat.No:R013946) is an organic compound used as an intermediate in chemical synthesis. It contains an amino group and a ketone group, making it valuable in the preparation of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its versatility contributes to its wide application in the synthesis of diverse compounds.
CAS Number | 99-92-3 |
Synonyms | 1-(4-Aminophenyl)ethanone; 1-(4-Aminophenyl)ethanone; 1-Acetyl-4-aminobenzene; 4-Acetylaniline; 4-Acetylphenylamine; 4-Aminophenyl Methyl Ketone; NSC 3242; p-Aminoacetophenone; |
Molecular Formula | C8H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(4-aminophenyl)ethanone |
InChI | InChI=1S/C8H9NO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,9H2,1H3 |
InChIKey | GPRYKVSEZCQIHD-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=C(C=C1)N |