For research use only. Not for therapeutic Use.
4’-Aminobenzanilide (Cat No.:R006909) is a chemical compound. It features an anilide core substituted with an aminobenzene group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Anilide derivatives like 4’-aminobenzanilide are important intermediates for creating diverse molecules, including pharmaceuticals and agrochemicals. The presence of an aminobenzene group adds reactivity and functional diversity to the compound. 4’-Aminobenzanilide’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 17625-83-1 |
Synonyms | Benzoic Acid-(4-amino-anilide); N-(4-Amino-phenyl)-benzamide; |
Molecular Formula | C13H12N2O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | N-(4-aminophenyl)benzamide |
InChI | InChI=1S/C13H12N2O/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h1-9H,14H2,(H,15,16) |
InChIKey | GTTFJYUWPUKXJH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)N |