For research use only. Not for therapeutic Use.
4-Aminocyclohexanecarbonitrile hydrochloride(CAT: L000057) is a significant compound with relevance in pharmaceutical and organic chemistry. This molecule serves as a valuable intermediate in the synthesis of pharmaceuticals, particularly in the development of drugs for neurological disorders and pain management. Its unique structural features, including the aminocyclohexane moiety, make it a versatile building block for designing bioactive compounds.
| Catalog Number | L000057 |
| CAS Number | 1387445-51-3 |
| Molecular Formula | C7H13ClN2 |
| Purity | ≥95% |
| IUPAC Name | 4-aminocyclohexane-1-carbonitrile;hydrochloride |
| InChI | InChI=1S/C7H12N2.ClH/c8-5-6-1-3-7(9)4-2-6;/h6-7H,1-4,9H2;1H |
| InChIKey | BTLVSLNZSMIPCW-UHFFFAOYSA-N |
