For research use only. Not for therapeutic Use.
4-Aminohippuric acid（Cat No.:I004333） is a diagnostic agent employed in medical tests that assess kidney function, particularly in the measurement of renal plasma flow. This compound is administered intravenously and acts as a marker to determine the blood flow rate in the kidneys. By monitoring the clearance of 4-Aminohippuric acid from the bloodstream, healthcare professionals can accurately estimate the renal plasma flow, providing valuable information about kidney function and potential abnormalities. Thus, 4-Aminohippuric acid serves as a valuable tool in diagnosing and monitoring kidney-related conditions.
| Catalog Number | I004333 |
| CAS Number | 61-78-9 |
| Molecular Formula | C9H10N2O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Solubility | H2O: ≥ 1.7 mg/mL |
| Storage | 3 years -20C powder |
| IUPAC Name | 2-[(4-aminobenzoyl)amino]acetic acid |
| InChI | InChI=1S/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13) |
| InChIKey | HSMNQINEKMPTIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)N |
| Reference | <p style=/line-height:25px/> |
