For research use only. Not for therapeutic Use.
4-Aminoindan is a bicyclic compound used in pharmaceutical research, particularly in the development of neuroactive and bioactive molecules. Its structure, which includes an indane ring with an amino group at the 4-position, makes it a valuable intermediate in the synthesis of drugs, especially those targeting neurological disorders like Parkinson’s disease. The compound’s unique reactivity allows for chemical modifications, supporting the design of enzyme inhibitors and receptor modulators. Its versatility contributes to advancements in medicinal chemistry and neuropharmacology research.
| Catalog Number | R028972 |
| CAS Number | 32202-61-2 |
| Synonyms | 4-Indanamine; 2,3-Dihydro-1H-inden-4-amine; 4-Aminoindane; Indan-4-ylamine |
| Molecular Formula | C9H11N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3-dihydro-1H-inden-4-amine |
| InChI | InChI=1S/C9H11N/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6H,1,3,5,10H2 |
| InChIKey | RXTJLDXSGNEJIT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)N |
