For research use only. Not for therapeutic Use.
4-Aminoisoquinoline-6-carboxylic acid is a heterocyclic compound featuring an isoquinoline ring with an amino group at the 4-position and a carboxylic acid group at the 6-position. This dual-functionalized structure offers both nucleophilic and acidic sites, making it a valuable intermediate in pharmaceutical research, particularly in synthesizing biologically active molecules. Known for its potential in drug discovery, it serves as a foundational building block in developing treatments targeting various biological pathways, especially in oncology and infectious disease research.
CAS Number | 1956332-68-5 |
Molecular Formula | C10H8N2O2 |
Purity | ≥95% |
IUPAC Name | 4-aminoisoquinoline-6-carboxylic acid |
InChI | InChI=1S/C10H8N2O2/c11-9-5-12-4-7-2-1-6(10(13)14)3-8(7)9/h1-5H,11H2,(H,13,14) |
InChIKey | IUYXRLRVPIBHQA-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=CC(=C2C=C1C(=O)O)N |