For research use only. Not for therapeutic Use.
4-Aminophenyl Disulfide(CAT: R070072) is an organic compound known for its applications in organic synthesis and materials science. This compound, featuring a disulfide bond between two aminophenyl groups, is particularly useful as a building block in the synthesis of more complex molecules, including polymers and specialty chemicals. 4-Aminophenyl Disulfide is also utilized in the study of redox reactions and disulfide exchange processes, making it valuable for research in fields such as biochemistry and pharmaceutical development. Its ability to form stable disulfide linkages contributes to its role in the design of functional materials and the modification of surfaces, offering researchers a versatile tool for exploring innovative applications in chemistry and material science.
CAS Number | 722-27-0 |
Molecular Formula | C12H12N2S2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-[(4-aminophenyl)disulfanyl]aniline |
InChI | InChI=1S/C12H12N2S2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
InChIKey | MERLDGDYUMSLAY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N)SSC2=CC=C(C=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |