For research use only. Not for therapeutic Use.
4-Aminopyridine-2,6-dicarboxylic acid(Cat No.:L036317)is a multifunctional organic compound featuring an aminopyridine core with two carboxylic acid groups. It serves as an important intermediate in synthesizing pharmaceuticals, particularly in designing drugs that target neurological conditions. The amino group on the pyridine ring allows for versatile chemical modifications, while the carboxylic acid groups enhance solubility and reactivity. This compound is studied for its potential in developing treatments for conditions like multiple sclerosis and other neurological disorders, where it may modulate ion channels or neurotransmitter systems.
Catalog Number | L036317 |
CAS Number | 2683-49-0 |
Molecular Formula | C7H6N2O4 |
Purity | ≥95% |
IUPAC Name | 4-aminopyridine-2,6-dicarboxylic acid |
InChI | InChI=1S/C7H6N2O4/c8-3-1-4(6(10)11)9-5(2-3)7(12)13/h1-2H,(H2,8,9)(H,10,11)(H,12,13) |
InChIKey | IHEBMGYEECNNJH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1C(=O)O)C(=O)O)N |