For research use only. Not for therapeutic Use.
4-Aminotetrahydropyran-4-carboxylic acid ethyl ester(CAT: L034944) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a tetrahydropyran ring with an amino group at the 4-position and an ethyl ester functional group at the carboxylic acid site, this compound serves as a versatile intermediate for synthesizing bioactive molecules and drug candidates. Its unique structure and reactivity make it valuable for medicinal chemistry applications, including the design of enzyme inhibitors and therapeutic agents. 4-Aminotetrahydropyran-4-carboxylic acid ethyl ester ensures consistent quality and performance, supporting innovation in drug discovery and advanced synthetic methodologies.
CAS Number | 246547-26-2 |
Molecular Formula | C8H15NO3 |
Purity | ≥95% |
IUPAC Name | ethyl 4-aminooxane-4-carboxylate |
InChI | InChI=1S/C8H15NO3/c1-2-12-7(10)8(9)3-5-11-6-4-8/h2-6,9H2,1H3 |
InChIKey | XYMJJESBEUZDJM-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1(CCOCC1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |