For research use only. Not for therapeutic Use.
4-Azatricyclo[4.3.1.1³,⁸]undecan-5-one(Cat No.:L006868), is a complex organic compound used in the field of organic synthesis and medicinal chemistry. Its unique structure includes a fused tricyclic ring system with a ketone functional group. This compound serves as a key intermediate in the synthesis of various complex natural products and pharmaceuticals. Researchers use it to explore structure-activity relationships and develop new drugs. Its intricate structure offers opportunities for diverse chemical modifications, enabling the creation of potential drug candidates.
Catalog Number | L006868 |
CAS Number | 22607-75-6 |
Molecular Formula | C10H15NO |
Purity | ≥95% |
IUPAC Name | 4-azatricyclo[4.3.1.13,8]undecan-5-one |
InChI | InChI=1S/C10H15NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-9H,1-5H2,(H,11,12) |
InChIKey | OKDJIRNQPPBDKJ-UHFFFAOYSA-N |
SMILES | C1C2CC3CC1CC(C2)NC3=O |