For research use only. Not for therapeutic Use.
4-(Azetidin-1-yl)benzaldehyde(Cat No.:L007607), is a chemical compound featuring a benzaldehyde core with an azetidine ring attached at the 1-position. This unique molecular structure is significant in medicinal chemistry and drug development. Researchers utilize it as a key intermediate for the synthesis of various organic molecules, especially in the design and creation of pharmaceutical agents. Its specific arrangement allows for diverse chemical modifications, enabling the development of compounds with potential biological activities.
CAS Number | 353247-81-1 |
Molecular Formula | C10H11NO |
Purity | ≥95% |
IUPAC Name | 4-(azetidin-1-yl)benzaldehyde |
InChI | InChI=1S/C10H11NO/c12-8-9-2-4-10(5-3-9)11-6-1-7-11/h2-5,8H,1,6-7H2 |
InChIKey | HXDXHWQUDGABHT-UHFFFAOYSA-N |
SMILES | C1CN(C1)C2=CC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |