For research use only. Not for therapeutic Use.
4-Azidobutyric acid is an organic compound characterized by a four-carbon chain terminating in a carboxylic acid group and an azide functional group. This structure makes it highly reactive and useful as a building block in chemical synthesis, particularly in click chemistry applications. The azide group allows for selective reactions that are valuable in modifying biomolecules, such as peptides and proteins, enabling researchers to study biological processes or develop new materials with specific functional properties.
CAS Number | 54447-68-6 |
Synonyms | 4-azidobutanoic acid;γ-azidobutyric acid |
Molecular Formula | C4H7N3O2 |
Purity | ≥95% |
Storage | Store at 0-8 °C |
IUPAC Name | 4-azidobutanoic acid |
InChI | InChI=1S/C4H7N3O2/c5-7-6-3-1-2-4(8)9/h1-3H2,(H,8,9) |
InChIKey | WAGMYTXJRVPMGW-UHFFFAOYSA-N |
SMILES | C(CC(=O)O)CN=[N+]=[N-] |