For research use only. Not for therapeutic Use.
4-(Benzofuran-2-yl)piperidine hydrochloride(Cat No.:L024737)is a crucial compound in medicinal chemistry, often used as a building block in the synthesis of various pharmaceutical agents. This compound combines a benzofuran moiety with a piperidine ring, enhancing its binding affinity in neuroactive drug development. It is particularly valued for its role in creating selective serotonin reuptake inhibitors (SSRIs) and other neurologically active compounds. The hydrochloride salt form increases its solubility and stability, making it ideal for research applications in drug discovery and development processes.
CAS Number | 54402-12-9 |
Molecular Formula | C13H16ClNO |
Purity | ≥95% |
IUPAC Name | 4-(1-benzofuran-2-yl)piperidine;hydrochloride |
InChI | InChI=1S/C13H15NO.ClH/c1-2-4-12-11(3-1)9-13(15-12)10-5-7-14-8-6-10;/h1-4,9-10,14H,5-8H2;1H |
InChIKey | BCUOZRGRZUTRTQ-UHFFFAOYSA-N |
SMILES | C1CNCCC1C2=CC3=CC=CC=C3O2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |