For research use only. Not for therapeutic Use.
4-Benzothiazolol(CAT: L014361) is a heterocyclic compound featuring a benzothiazole core with a hydroxyl group at the 4-position. This versatile molecule serves as a key intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive compounds such as enzyme inhibitors, antimicrobial agents, and fluorescent probes. Its unique structure, combining aromaticity and a functional hydroxyl group, allows for targeted modifications and derivatization. 4-Benzothiazolol offers excellent stability and reactivity, making it an essential building block for medicinal chemistry, material science, and the creation of advanced molecular frameworks for innovative applications.
CAS Number | 7405-23-4 |
Molecular Formula | C7H5NOS |
Purity | ≥95% |
IUPAC Name | 1,3-benzothiazol-4-ol |
InChI | InChI=1S/C7H5NOS/c9-5-2-1-3-6-7(5)8-4-10-6/h1-4,9H |
InChIKey | NZFKDDMHHUEVPI-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)SC=N2)O |