For research use only. Not for therapeutic Use.
4-Benzoylbenzaldehyde(Cat No.:L006680), is a chemical compound featuring a benzaldehyde core with an additional benzoyl group attached at the 4th position. This compound is crucial in organic synthesis and pharmaceutical research, serving as a versatile building block. Its specific structure makes it valuable in the creation of diverse molecules, especially in the development of pharmaceuticals and organic materials. Researchers use compounds like 4-benzoylbenzaldehyde as intermediates to synthesize complex organic compounds due to their reactivity, contributing significantly to advancements in drug discovery and materials science.
CAS Number | 20912-50-9 |
Molecular Formula | C14H10O2 |
Purity | ≥95% |
IUPAC Name | 4-benzoylbenzaldehyde |
InChI | InChI=1S/C14H10O2/c15-10-11-6-8-13(9-7-11)14(16)12-4-2-1-3-5-12/h1-10H |
InChIKey | MLZBRARCTFICSV-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |