For research use only. Not for therapeutic Use.
4-Benzyl-3-phenylpiperazin-2-one (CAT: L000172) is a chemical compound with notable applications in organic chemistry and potentially in pharmaceutical research. Its action mechanism involves its role as a piperazinone derivative, making it a valuable component in various chemical reactions. In organic chemistry, this compound serves as a versatile intermediate for the synthesis of pharmaceutical compounds and specialty chemicals. It has the potential to play a crucial role in the development of potential drugs, particularly in the pharmaceutical industry, contributing to the design and creation of novel therapeutic molecules.
CAS Number | 5368-23-0 |
Molecular Formula | C17H18N2O |
Purity | ≥95% |
IUPAC Name | 4-benzyl-3-phenylpiperazin-2-one |
InChI | InChI=1S/C17H18N2O/c20-17-16(15-9-5-2-6-10-15)19(12-11-18-17)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,18,20) |
InChIKey | JUWZYKUNWPTANZ-UHFFFAOYSA-N |