For research use only. Not for therapeutic Use.
4-(Benzylamino)benzonitrile(Cat No.:L007717), is a chemical compound consisting of a benzonitrile group with an attached benzylamino moiety. This specific structure is essential in medicinal chemistry and organic synthesis. Researchers utilize it as a valuable intermediate for the synthesis of diverse organic compounds, particularly in the development of pharmaceuticals. Its applications include drug discovery, where it serves as a key building block for potential therapeutic agents.
CAS Number | 10282-32-3 |
Molecular Formula | C14H12N2 |
Purity | ≥95% |
IUPAC Name | 4-(benzylamino)benzonitrile |
InChI | InChI=1S/C14H12N2/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9,16H,11H2 |
InChIKey | QIGBIJOPTRWSPF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)C#N |