Home
>
Chemical Reagents>Organic Building Blocks> 4-Benzylidene-2,6-di-tert-butylcyclohexa-2,5-dien-1-one
For research use only. Not for therapeutic Use.
4-Benzylidene-2,6-di-tert-butylcyclohexa-2,5-dien-1-one (Cat.No:L003432) is a crucial compound in organic synthesis. Its distinctive cyclohexadienone scaffold is employed as a versatile building block for various functional materials and pharmaceutical intermediates. This compound’s robust structure, combined with its ease of derivatization, makes it a valuable tool in the development of advanced materials and the synthesis of complex organic molecules.
CAS Number | 7078-98-0 |
Molecular Formula | C21H26O |
Purity | ≥95% |
IUPAC Name | 4-benzylidene-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C21H26O/c1-20(2,3)17-13-16(12-15-10-8-7-9-11-15)14-18(19(17)22)21(4,5)6/h7-14H,1-6H3 |
InChIKey | HCUWXYBKPSKTAB-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC2=CC=CC=C2)C=C(C1=O)C(C)(C)C |