For research use only. Not for therapeutic Use.
4-[Bis(2-chloroethyl)amino]benzonitrile(Cat No.:L007870). This compound features a benzonitrile ring substituted with two 2-chloroethylamine groups. It is a derivative of nitrogen mustard, a class of chemical compounds known for their alkylating properties and used in cancer chemotherapy. Compounds like these target rapidly dividing cells, interfering with their DNA replication and leading to cell death. Research on nitrogen mustards and related compounds continues in the development of new cancer treatments, making this compound significant in the field of oncology and medicinal chemistry.
CAS Number | 71601-35-9 |
Molecular Formula | C11H12Cl2N2 |
Purity | ≥95% |
IUPAC Name | 4-[bis(2-chloroethyl)amino]benzonitrile |
InChI | InChI=1S/C11H12Cl2N2/c12-5-7-15(8-6-13)11-3-1-10(9-14)2-4-11/h1-4H,5-8H2 |
InChIKey | VDPIEHNUNDVINZ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#N)N(CCCl)CCCl |