For research use only. Not for therapeutic Use.
4-Bromo-1-(4-fluorophenyl)-1H-imidazole is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a bromine atom at the 4-position and a fluorophenyl group at the 1-position, this imidazole derivative serves as a valuable building block for the synthesis of novel bioactive molecules. Its unique structure makes it useful in drug discovery, particularly for targeting specific enzymes and receptors. This compound is ideal for studies in medicinal chemistry, molecular biology, and material sciences.
Catalog Number | L036544 |
CAS Number | 623577-59-3 |
Molecular Formula | C9H6BrFN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-1-(4-fluorophenyl)imidazole |
InChI | InChI=1S/C9H6BrFN2/c10-9-5-13(6-12-9)8-3-1-7(11)2-4-8/h1-6H |
InChIKey | BZRDUINZBROYAQ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N2C=C(N=C2)Br)F |