For research use only. Not for therapeutic Use.
4-Bromo-1-chloro-2-iodobenzene(CAT: L040108) is a halogenated aromatic compound commonly employed as a building block in organic synthesis, especially in pharmaceutical and agrochemical research. This benzene derivative contains bromine, chlorine, and iodine atoms, offering multiple reactive sites for further modification. Its structure makes it suitable for use in transition metal-catalyzed coupling reactions, such as Suzuki or Sonogashira couplings, enabling the synthesis of complex molecules. 4-Bromo-1-chloro-2-iodobenzene is valuable in developing bioactive molecules, material science applications, and advanced chemical research, providing a versatile starting point for creating diverse functional compounds.
CAS Number | 774608-49-0 |
Molecular Formula | C6H3BrClI |
Purity | ≥95% |
IUPAC Name | 4-bromo-1-chloro-2-iodobenzene |
InChI | InChI=1S/C6H3BrClI/c7-4-1-2-5(8)6(9)3-4/h1-3H |
InChIKey | JNVDPJAUWVJWAB-UHFFFAOYSA-N |