For research use only. Not for therapeutic Use.
4-Bromo-1-methyl-1H-imidazole-5-carbonitrile(CAT: L000300) is a compound of relevance in material and organic chemistry. This chemical is used in the synthesis of various organic compounds and materials. Its action method involves serving as an intermediate for introducing specific functional groups in organic synthesis. In material chemistry, it plays a role in the preparation of specialized materials, often applied in the development of advanced materials with tailored properties.
CAS Number | 54711-55-6 |
Molecular Formula | C5H4BrN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-3-methylimidazole-4-carbonitrile |
InChI | InChI=1S/C5H4BrN3/c1-9-3-8-5(6)4(9)2-7/h3H,1H3 |
InChIKey | VXBCJVPQROXYNY-UHFFFAOYSA-N |