For research use only. Not for therapeutic Use.
4-Bromo-1-methyl-1H-pyrazolo[3,4-c]pyridine is an organic compound characterized by a fused pyrazole-pyridine structure. It features a bromine atom at the fourth position and a methyl group at the first position. Its chemical formula is C₉H₈BrN₃. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and anti-inflammatory properties. The presence of the bromine and methyl groups enhances its reactivity, making it a valuable scaffold for the development of novel pharmaceuticals and other bioactive molecules.
CAS Number | 1032943-41-1 |
Molecular Formula | C7H6BrN3 |
Purity | ≥95% |
IUPAC Name | 4-bromo-1-methylpyrazolo[3,4-c]pyridine |
InChI | InChI=1S/C7H6BrN3/c1-11-7-4-9-3-6(8)5(7)2-10-11/h2-4H,1H3 |
InChIKey | JKJHQTNGESACSE-UHFFFAOYSA-N |
SMILES | CN1C2=CN=CC(=C2C=N1)Br |