For research use only. Not for therapeutic Use.
4′-Bromo-[1,1′-biphenyl]-4-carbonitrile(Cat No.:L006907), is a significant organic compound used in chemical research and synthesis. Its molecular structure includes a biphenyl ring with a nitrile group at the 4th position and a bromine atom at the 4′-position. This compound serves as a valuable intermediate in the preparation of various organic derivatives. Researchers utilize it to create complex molecules, including pharmaceuticals, agrochemicals, and materials.
CAS Number | 57774-35-3 |
Molecular Formula | C13H8BrN |
Purity | ≥95% |
IUPAC Name | 4-(4-bromophenyl)benzonitrile |
InChI | InChI=1S/C13H8BrN/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-8H |
InChIKey | BHVHKOVPWZKVCC-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |