For research use only. Not for therapeutic Use.
4-Bromo-1,1-difluorobut-1-ene(CAT: M101053) is a high-purity fluorinated alkene widely employed in pharmaceutical, agrochemical, and material science research. Featuring a bromine atom and two fluorine substituents, this compound combines reactivity and stability, making it an essential building block for synthesizing complex organic molecules. Its unique structure facilitates applications in drug discovery, polymer development, and advanced chemical synthesis. 4-Bromo-1,1-difluorobut-1-ene ensures reliable performance and adaptability, supporting innovative approaches in medicinal chemistry and industrial research.
CAS Number | 147804-02-2 |
Molecular Formula | C4H5BrF2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 4-bromo-1,1-difluorobut-1-ene |
InChI | InChI=1S/C4H5BrF2/c5-3-1-2-4(6)7/h2H,1,3H2 |
InChIKey | WSIDFIREQDHYPW-UHFFFAOYSA-N |
SMILES | C(CBr)C=C(F)F |