For research use only. Not for therapeutic Use.
4-Bromo-1H-indazole-6-carboxylic acid(Cat No.:L012100)is a brominated indazole derivative widely used in pharmaceutical research and organic synthesis. The compound features a bromine atom at the 4-position and a carboxylic acid group at the 6-position on the indazole ring, making it a valuable intermediate in developing bioactive molecules. It is particularly significant in creating potential therapeutic agents targeting cancer, inflammation, and neurological disorders. The unique structure and reactivity of 4-Bromo-1H-indazole-6-carboxylic acid make it an essential building block for medicinal chemists engaged in innovative drug discovery and development.
CAS Number | 885523-43-3 |
Molecular Formula | C8H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-1H-indazole-6-carboxylic acid |
InChI | InChI=1S/C8H5BrN2O2/c9-6-1-4(8(12)13)2-7-5(6)3-10-11-7/h1-3H,(H,10,11)(H,12,13) |
InChIKey | PTPANGLJLZZYNH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C2=C1NN=C2)Br)C(=O)O |