For research use only. Not for therapeutic Use.
4-Bromo-1H-indene(Cat No.:L022885)is a brominated aromatic compound featuring a bromine atom attached to the 4-position of an indene ring system. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and advanced materials. The bromine atom provides a reactive site for further functionalization, making it a versatile intermediate in cross-coupling reactions and other chemical transformations. Its indene backbone, with a fused five- and six-membered ring, contributes to the synthesis of complex molecules, including biologically active compounds and specialty chemicals.
CAS Number | 45738-35-0 |
Molecular Formula | C9H7Br |
Purity | ≥95% |
IUPAC Name | 4-bromo-1H-indene |
InChI | InChI=1S/C9H7Br/c10-9-6-2-4-7-3-1-5-8(7)9/h1-2,4-6H,3H2 |
InChIKey | KVPMZHAGRCBCAD-UHFFFAOYSA-N |
SMILES | C1C=CC2=C1C=CC=C2Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |