(4-bromo-1H-pyrazol-1-yl)acetonitrile

For research use only. Not for therapeutic Use.

  • CAT Number: L021077
  • CAS Number: 925224-08-4
  • Molecular Formula: C5H4BrN3
  • Molecular Weight: 186.01
  • Purity: ≥95%
Inquiry Now

(4-Bromo-1H-pyrazol-1-yl)acetonitrile(Cat No.:L021077)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. This molecule features a pyrazole ring with a bromine atom at the 4-position and an acetonitrile group attached to the nitrogen atom, making it a versatile intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations. (4-Bromo-1H-pyrazol-1-yl)acetonitrile is essential for precise synthetic applications, supporting advancements in medicinal chemistry and innovative research.


CAS Number 925224-08-4
Molecular Formula C5H4BrN3
Purity ≥95%
IUPAC Name 2-(4-bromopyrazol-1-yl)acetonitrile
InChI InChI=1S/C5H4BrN3/c6-5-3-8-9(4-5)2-1-7/h3-4H,2H2
InChIKey MIKIWDXOQIASTM-UHFFFAOYSA-N
SMILES C1=C(C=NN1CC#N)Br

Request a Quote