For research use only. Not for therapeutic Use.
4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one(Cat No.:L039636)is a heterocyclic compound featuring a bromine atom at the 4-position on a pyrrolopyridinone core. This compound is commonly used in pharmaceutical research and organic synthesis as a key intermediate for the development of biologically active molecules, including potential drug candidates. Its brominated structure allows for versatile reactivity, particularly in cross-coupling reactions, making it valuable for constructing complex heterocycles. Researchers in medicinal chemistry utilize this compound to explore innovative therapeutic agents and novel chemical transformations.
CAS Number | 1190318-93-4 |
Molecular Formula | C7H5BrN2O |
Purity | ≥95% |
IUPAC Name | 4-bromo-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
InChI | InChI=1S/C7H5BrN2O/c8-5-2-9-3-6-4(5)1-7(11)10-6/h2-3H,1H2,(H,10,11) |
InChIKey | KZNIAYMPFKNABU-UHFFFAOYSA-N |
SMILES | C1C2=C(C=NC=C2NC1=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |