For research use only. Not for therapeutic Use.
4-Bromo-2-chloro-5-nitroaniline(CAT: L037572) is a high-purity aromatic compound widely utilized in pharmaceutical and chemical research. Featuring a bromine, chlorine, and nitro group attached to an aniline core, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including pharmaceuticals, dyes, and agrochemicals. Its multifunctional structure enables participation in diverse chemical reactions, such as halogen substitution and nitration, facilitating the creation of tailored derivatives. Ideal for advanced synthetic applications, 4-Bromo-2-chloro-5-nitroaniline ensures consistent performance, supporting innovative research and development in various scientific fields.
CAS Number | 872820-00-3 |
Molecular Formula | C6H4BrClN2O2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-chloro-5-nitroaniline |
InChI | InChI=1S/C6H4BrClN2O2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H,9H2 |
InChIKey | OZMQSRBHILCYPE-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)Cl)N |