For research use only. Not for therapeutic Use.
4-Bromo-2-(chloromethyl)thiophene is an organic compound featuring a thiophene ring with a bromine atom at the 4-position and a chloromethyl group (-CH₂Cl) at the 2-position. The halogenated substituents enhance the reactivity of the compound, making it useful in organic synthesis. This structure allows for further functionalization, such as nucleophilic substitution or cross-coupling reactions. It is often used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other bioactive molecules, with potential applications in materials science as well.
CAS Number | 170859-70-8 |
Molecular Formula | C5H4BrClS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-2-(chloromethyl)thiophene |
InChI | InChI=1S/C5H4BrClS/c6-4-1-5(2-7)8-3-4/h1,3H,2H2 |
InChIKey | JOPVYZZZKLTMMD-UHFFFAOYSA-N |
SMILES | C1=C(SC=C1Br)CCl |