For research use only. Not for therapeutic Use.
4-Bromo-2-(difluoromethyl)-1-methoxybenzene(Cat No.:L026956)is a high-purity aromatic compound widely used in pharmaceutical research and chemical synthesis. Featuring a bromine atom and a difluoromethyl group on a methoxy-substituted benzene ring, this compound is a versatile intermediate in the creation of complex organic molecules. It is particularly valuable in the synthesis of bioactive compounds and drug candidates, offering enhanced reactivity and stability. Ideal for use in medicinal chemistry and material science, this compound provides reliability and precision in advanced research and development applications.
CAS Number | 1261512-49-5 |
Molecular Formula | C8H7BrF2O |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-(difluoromethyl)-1-methoxybenzene |
InChI | InChI=1S/C8H7BrF2O/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4,8H,1H3 |
InChIKey | ICCUJGHZHVIYDJ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)Br)C(F)F |