For research use only. Not for therapeutic Use.
4-Bromo-2-fluoro-1,3-dimethoxybenzene (Cat.No:L003494) is a notable chemical compound with applications in pharmaceutical and agrochemical research. Its distinct structure, featuring bromine and fluorine substitutions, lends itself to diverse synthetic pathways. This compound serves as a valuable building block for the creation of specialized molecules, showcasing its significance in the development of novel drugs and agricultural chemicals.
Catalog Number | L003494 |
CAS Number | 222547-68-4 |
Molecular Formula | C8H8BrFO2 |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-fluoro-2,4-dimethoxybenzene |
InChI | InChI=1S/C8H8BrFO2/c1-11-6-4-3-5(9)8(12-2)7(6)10/h3-4H,1-2H3 |
InChIKey | PFJBJBLXZJRUBQ-UHFFFAOYSA-N |
SMILES | COC1=C(C(=C(C=C1)Br)OC)F |