For research use only. Not for therapeutic Use.
4-Bromo-2-fluoro-3-methoxybenzaldehyde is an aromatic aldehyde characterized by a bromine atom at the 4-position, a fluorine atom at the 2-position, and a methoxy group at the 3-position. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate for various bioactive molecules. The presence of halogen substituents enhances its reactivity, facilitating further functionalization. Its unique structure allows for versatile modifications, making it valuable in the development of pharmaceuticals and exploring new chemical applications.
CAS Number | 1820614-17-2 |
Molecular Formula | C8H6BrFO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-fluoro-3-methoxybenzaldehyde |
InChI | InChI=1S/C8H6BrFO2/c1-12-8-6(9)3-2-5(4-11)7(8)10/h2-4H,1H3 |
InChIKey | YFEKAAWOIBRRRZ-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1F)C=O)Br |