For research use only. Not for therapeutic Use.
4-Bromo-2-fluoro-5-nitrobenzaldehyde(CAT: L041574) is a halogenated aromatic compound featuring a bromine atom at the 4-position, a fluorine atom at the 2-position, a nitro group at the 5-position, and an aldehyde functional group. This compound is widely utilized in pharmaceutical and chemical research as a key intermediate in the synthesis of bioactive molecules and heterocyclic compounds. Its combination of electron-withdrawing groups enhances its reactivity, making it ideal for functional group transformations and the development of complex organic structures. With high purity and stability, 4-Bromo-2-fluoro-5-nitrobenzaldehyde is a valuable building block for advanced drug discovery and material science applications.
CAS Number | 679839-39-5 |
Molecular Formula | C7H3BrFNO3 |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-fluoro-5-nitrobenzaldehyde |
InChI | InChI=1S/C7H3BrFNO3/c8-5-2-6(9)4(3-11)1-7(5)10(12)13/h1-3H |
InChIKey | ZAROJBMUUUKZBH-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)C=O |