For research use only. Not for therapeutic Use.
4-Bromo-2-fluoro-6-methoxybenzonitrile(CAT: L040694) is an aromatic compound with a benzonitrile core substituted by a bromine atom at the 4th position, a fluorine atom at the 2nd position, and a methoxy group at the 6th position. This structure makes it a valuable intermediate in the synthesis of complex organic molecules, especially in the pharmaceutical and agrochemical industries. The bromine and fluorine atoms provide sites for further functionalization through cross-coupling reactions such as Suzuki or Buchwald-Hartwig couplings. The methoxy group adds polarity and reactivity, making the compound suitable for fine chemical synthesis, particularly in the design of biologically active molecules or novel materials.
CAS Number | 457051-15-9 |
Molecular Formula | C8H5BrFNO |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-fluoro-6-methoxybenzonitrile |
InChI | InChI=1S/C8H5BrFNO/c1-12-8-3-5(9)2-7(10)6(8)4-11/h2-3H,1H3 |
InChIKey | RCVMSHGRUGIUOD-UHFFFAOYSA-N |