For research use only. Not for therapeutic Use.
4-Bromo-2-fluorophenylacetic acid(Cat No.:M020161)is a high-purity chemical compound widely used in pharmaceutical research and organic synthesis. This halogenated phenylacetic acid derivative, featuring both bromine and fluorine substituents, serves as a key intermediate in the development of various bioactive molecules. Its unique structure allows for versatile applications in medicinal chemistry, particularly in the synthesis of complex aromatic compounds. 4-Bromo-2-fluorophenylacetic acid is essential for research focused on creating new therapeutic agents and optimizing synthetic pathways, providing reliable performance in advanced chemical synthesis.
CAS Number | 114897-92-6 |
Synonyms | 4-Bromo-2-fluorophenylacetic acid |
Molecular Formula | C8H6BrFO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-bromo-2-fluorophenyl)acetic acid |
InChI | InChI=1S/C8H6BrFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) |
InChIKey | PNBIYFPZODYMOO-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)F)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |