For research use only. Not for therapeutic Use.
4-Bromo-2-iodobenzaldehyde(Cat No.:L033590)is a high-purity aromatic aldehyde widely utilized in pharmaceutical and chemical research. This compound features a bromine atom at the 4-position and an iodine atom at the 2-position on a benzaldehyde core, making it a versatile intermediate in the synthesis of complex organic molecules, including potential drug candidates and fine chemicals. Its unique structure allows for selective reactivity in various chemical transformations, supporting the development of novel therapeutic agents. 4-Bromo-2-iodobenzaldehyde is ideal for precise synthetic applications in medicinal chemistry.
CAS Number | 1261470-87-4 |
Molecular Formula | C7H4BrIO |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-iodobenzaldehyde |
InChI | InChI=1S/C7H4BrIO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
InChIKey | JFFYPBIPKMTEEQ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)I)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |