For research use only. Not for therapeutic Use.
4-Bromo-2-methoxycarbonylbenzenesulfonamide(Cat No.:L007861). It is a sulfonamide derivative featuring a bromine atom at the 4-position, a methoxycarbonyl group at the 2-position, and a benzenesulfonamide moiety. Compounds with sulfonamide groups are significant in medicinal chemistry, often used as inhibitors in enzyme reactions. The presence of the bromine atom adds reactivity, allowing for various chemical transformations. Such compounds are essential in pharmaceutical research, serving as intermediates for the synthesis of potential drug candidates and other bioactive molecules, contributing to advancements in drug discovery and related scientific research.
Catalog Number | L007861 |
CAS Number | 953742-67-1 |
Molecular Formula | C8H8BrNO4S |
Purity | ≥95% |
IUPAC Name | methyl 5-bromo-2-sulfamoylbenzoate |
InChI | InChI=1S/C8H8BrNO4S/c1-14-8(11)6-4-5(9)2-3-7(6)15(10,12)13/h2-4H,1H3,(H2,10,12,13) |
InChIKey | IOUZMYSQUNWZAF-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CC(=C1)Br)S(=O)(=O)N |